C25H29FN2O7 — CID 145070220
2-[[2-[7-[(2-fluoro-5-methoxyphenyl)methoxy]-3-oxo-1H-isoindol-2-yl]-2-hydroxypentanoyl]amino]propan-2-yl formate (PubChem CID 145070220) has the molecular formula C25H29FN2O7 and a molecular weight of 488.51 g/mol. Its IUPAC name is 2-[[2-[7-[(2-fluoro-5-methoxyphenyl)methoxy]-3-oxo-1H-isoindol-2-yl]-2-hydroxypentanoyl]amino]propan-2-yl formate.
| Compound Name | 2-[[2-[7-[(2-fluoro-5-methoxyphenyl)methoxy]-3-oxo-1H-isoindol-2-yl]-2-hydroxypentanoyl]amino]propan-2-yl formate |
|---|---|
| PubChem CID | 145070220 |
| Molecular Formula | C25H29FN2O7 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 2-[[2-[7-[(2-fluoro-5-methoxyphenyl)methoxy]-3-oxo-1H-isoindol-2-yl]-2-hydroxypentanoyl]amino]propan-2-yl formate |
| SMILES | CCCC(O)(C(=O)NC(C)(C)OC=O)N1Cc2c(OCc3cc(OC)ccc3F)cccc2C1=O |
| InChI | InChI=1S/C25H29FN2O7/c1-5-11-25(32,23(31)27-24(2,3)35-15-29)28-13-19-18(22(28)30)7-6-8-21(19)34-14-16-12-17(33-4)9-10-20(16)26/h6-10,12,15,32H,5,11,13-14H2,1-4H3,(H,27,31) |
| InChIKey | BZJFLOUGLAZWMB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|