C23H23FN4O5 — CID 121314573
[3-[[[2-[(3R)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]amino]methyl]-4-fluorophenyl] N,N-dimethylcarbamate (PubChem CID 121314573) has the molecular formula C23H23FN4O5 and a molecular weight of 454.46 g/mol. Its IUPAC name is [3-[[[2-[(3R)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]amino]methyl]-4-fluorophenyl] N,N-dimethylcarbamate.
| Compound Name | [3-[[[2-[(3R)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]amino]methyl]-4-fluorophenyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 121314573 |
| Molecular Formula | C23H23FN4O5 |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | [3-[[[2-[(3R)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]amino]methyl]-4-fluorophenyl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1ccc(F)c(CNc2cccc3c2CN([C@@H]2CCC(=O)NC2=O)C3=O)c1 |
| InChI | InChI=1S/C23H23FN4O5/c1-27(2)23(32)33-14-6-7-17(24)13(10-14)11-25-18-5-3-4-15-16(18)12-28(22(15)31)19-8-9-20(29)26-21(19)30/h3-7,10,19,25H,8-9,11-12H2,1-2H3,(H,26,29,30)/t19-/m1/s1 |
| InChIKey | AANJSSHWVAVGME-LJQANCHMSA-N |
| XLogP | 2.26 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|