C27H29FN4O6 — CID 140817422
2-[3-[[[2-[(3R)-3-deuterio-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]amino]methyl]-4-fluorophenoxy]ethyl pyrrolidine-1-carboxylate (PubChem CID 140817422) has the molecular formula C27H29FN4O6 and a molecular weight of 525.56 g/mol. Its IUPAC name is 2-[3-[[[2-[(3R)-3-deuterio-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]amino]methyl]-4-fluorophenoxy]ethyl pyrrolidine-1-carboxylate.
| Compound Name | 2-[3-[[[2-[(3R)-3-deuterio-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]amino]methyl]-4-fluorophenoxy]ethyl pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 140817422 |
| Molecular Formula | C27H29FN4O6 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | 2-[3-[[[2-[(3R)-3-deuterio-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]amino]methyl]-4-fluorophenoxy]ethyl pyrrolidine-1-carboxylate |
| SMILES | [2H][C@@]1(N2Cc3c(NCc4cc(OCCOC(=O)N5CCCC5)ccc4F)cccc3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C27H29FN4O6/c28-21-7-6-18(37-12-13-38-27(36)31-10-1-2-11-31)14-17(21)15-29-22-5-3-4-19-20(22)16-32(26(19)35)23-8-9-24(33)30-25(23)34/h3-7,14,23,29H,1-2,8-13,15-16H2,(H,30,33,34)/t23-/m1/s1/i23D |
| InChIKey | LYQHVZZGIXVOJU-ONSOOCHESA-N |
| XLogP | 2.81 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|