C21H20FN3O3 — CID 140817766
3-deuterio-3-[7-[(3-fluoro-4-methylphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 140817766) has the molecular formula C21H20FN3O3 and a molecular weight of 382.41 g/mol. Its IUPAC name is 3-deuterio-3-[7-[(3-fluoro-4-methylphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-deuterio-3-[7-[(3-fluoro-4-methylphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 140817766 |
| Molecular Formula | C21H20FN3O3 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 3-deuterio-3-[7-[(3-fluoro-4-methylphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [2H]C1(N2Cc3c(NCc4ccc(C)c(F)c4)cccc3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C21H20FN3O3/c1-12-5-6-13(9-16(12)22)10-23-17-4-2-3-14-15(17)11-25(21(14)28)18-7-8-19(26)24-20(18)27/h2-6,9,18,23H,7-8,10-11H2,1H3,(H,24,26,27)/i18D |
| InChIKey | GZDNAZFPMHQWBZ-VAAKKRCDSA-N |
| XLogP | 2.51 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|