C20H19FN4O5S — CID 140817445
3-[[[2-[(3S)-3-deuterio-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]amino]methyl]-2-fluorobenzenesulfonamide (PubChem CID 140817445) has the molecular formula C20H19FN4O5S and a molecular weight of 447.47 g/mol. Its IUPAC name is 3-[[[2-[(3S)-3-deuterio-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]amino]methyl]-2-fluorobenzenesulfonamide.
| Compound Name | 3-[[[2-[(3S)-3-deuterio-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]amino]methyl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 140817445 |
| Molecular Formula | C20H19FN4O5S |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 3-[[[2-[(3S)-3-deuterio-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]amino]methyl]-2-fluorobenzenesulfonamide |
| SMILES | [2H][C@]1(N2Cc3c(NCc4cccc(S(N)(=O)=O)c4F)cccc3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C20H19FN4O5S/c21-18-11(3-1-6-16(18)31(22,29)30)9-23-14-5-2-4-12-13(14)10-25(20(12)28)15-7-8-17(26)24-19(15)27/h1-6,15,23H,7-10H2,(H2,22,29,30)(H,24,26,27)/t15-/m0/s1/i15D |
| InChIKey | LAUXSHZGAQMDLT-IPAYDBEPSA-N |
| XLogP | 0.85 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|