C21H17FN4O3 — CID 140817979
(3S)-3-deuterio-3-[7-[(2-fluoro-3-isocyanophenyl)methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 140817979) has the molecular formula C21H17FN4O3 and a molecular weight of 393.40 g/mol. Its IUPAC name is (3S)-3-deuterio-3-[7-[(2-fluoro-3-isocyanophenyl)methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-deuterio-3-[7-[(2-fluoro-3-isocyanophenyl)methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 140817979 |
| Molecular Formula | C21H17FN4O3 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | (3S)-3-deuterio-3-[7-[(2-fluoro-3-isocyanophenyl)methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [2H][C@]1(N2Cc3c(NCc4cccc([N+]#[C-])c4F)cccc3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C21H17FN4O3/c1-23-16-7-2-4-12(19(16)22)10-24-15-6-3-5-13-14(15)11-26(21(13)29)17-8-9-18(27)25-20(17)28/h2-7,17,24H,8-11H2,(H,25,27,28)/t17-/m0/s1/i17D |
| InChIKey | LKILMPOXIIDUEI-VYIZDPFKSA-N |
| XLogP | 2.75 |
| TPSA | 82.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|