C22H23N3O3 — CID 140817361
(3S)-3-deuterio-3-[7-[(3,4-dimethylphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 140817361) has the molecular formula C22H23N3O3 and a molecular weight of 378.45 g/mol. Its IUPAC name is (3S)-3-deuterio-3-[7-[(3,4-dimethylphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-deuterio-3-[7-[(3,4-dimethylphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 140817361 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (3S)-3-deuterio-3-[7-[(3,4-dimethylphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [2H][C@]1(N2Cc3c(NCc4ccc(C)c(C)c4)cccc3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C22H23N3O3/c1-13-6-7-15(10-14(13)2)11-23-18-5-3-4-16-17(18)12-25(22(16)28)19-8-9-20(26)24-21(19)27/h3-7,10,19,23H,8-9,11-12H2,1-2H3,(H,24,26,27)/t19-/m0/s1/i19D |
| InChIKey | BWQGPIFIZFBUNA-MDGSFACESA-N |
| XLogP | 2.68 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|