C21H20ClN3O4 — CID 121314503
(3S)-3-[7-[(3-chloro-4-methoxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 121314503) has the molecular formula C21H20ClN3O4 and a molecular weight of 413.86 g/mol. Its IUPAC name is (3S)-3-[7-[(3-chloro-4-methoxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[7-[(3-chloro-4-methoxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 121314503 |
| Molecular Formula | C21H20ClN3O4 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | (3S)-3-[7-[(3-chloro-4-methoxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COc1ccc(CNc2cccc3c2CN([C@H]2CCC(=O)NC2=O)C3=O)cc1Cl |
| InChI | InChI=1S/C21H20ClN3O4/c1-29-18-7-5-12(9-15(18)22)10-23-16-4-2-3-13-14(16)11-25(21(13)28)17-6-8-19(26)24-20(17)27/h2-5,7,9,17,23H,6,8,10-11H2,1H3,(H,24,26,27)/t17-/m0/s1 |
| InChIKey | IYKXCMAJRVIVJW-KRWDZBQOSA-N |
| XLogP | 2.72 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|