C22H23N3O5 — CID 140817986
3-deuterio-3-[7-[(3,5-dimethoxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 140817986) has the molecular formula C22H23N3O5 and a molecular weight of 410.45 g/mol. Its IUPAC name is 3-deuterio-3-[7-[(3,5-dimethoxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-deuterio-3-[7-[(3,5-dimethoxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 140817986 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 3-deuterio-3-[7-[(3,5-dimethoxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [2H]C1(N2Cc3c(NCc4cc(OC)cc(OC)c4)cccc3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C22H23N3O5/c1-29-14-8-13(9-15(10-14)30-2)11-23-18-5-3-4-16-17(18)12-25(22(16)28)19-6-7-20(26)24-21(19)27/h3-5,8-10,19,23H,6-7,11-12H2,1-2H3,(H,24,26,27)/i19D |
| InChIKey | UIKLMZAPBQDRNA-YUIGOLOMSA-N |
| XLogP | 2.08 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|