C25H27FN4O7 — CID 145070351
3-[7-[[2-fluoro-5-(morpholin-4-ylmethyl)phenyl]methylamino]-1,1-dihydroxy-3-oxoisoindol-2-yl]-3-hydroxypiperidine-2,6-dione (PubChem CID 145070351) has the molecular formula C25H27FN4O7 and a molecular weight of 514.51 g/mol. Its IUPAC name is 3-[7-[[2-fluoro-5-(morpholin-4-ylmethyl)phenyl]methylamino]-1,1-dihydroxy-3-oxoisoindol-2-yl]-3-hydroxypiperidine-2,6-dione.
| Compound Name | 3-[7-[[2-fluoro-5-(morpholin-4-ylmethyl)phenyl]methylamino]-1,1-dihydroxy-3-oxoisoindol-2-yl]-3-hydroxypiperidine-2,6-dione |
|---|---|
| PubChem CID | 145070351 |
| Molecular Formula | C25H27FN4O7 |
| Molecular Weight | 514.51 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 3-[7-[[2-fluoro-5-(morpholin-4-ylmethyl)phenyl]methylamino]-1,1-dihydroxy-3-oxoisoindol-2-yl]-3-hydroxypiperidine-2,6-dione |
| SMILES | O=C1CCC(O)(N2C(=O)c3cccc(NCc4cc(CN5CCOCC5)ccc4F)c3C2(O)O)C(=O)N1 |
| InChI | InChI=1S/C25H27FN4O7/c26-18-5-4-15(14-29-8-10-37-11-9-29)12-16(18)13-27-19-3-1-2-17-21(19)25(35,36)30(22(17)32)24(34)7-6-20(31)28-23(24)33/h1-5,12,27,34-36H,6-11,13-14H2,(H,28,31,33) |
| InChIKey | VPWBRVBHKBQTGE-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 151.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.51 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|