C27H33FN4O6 — CID 145070586
ethane;3-[7-[[2-fluoro-5-(morpholin-4-ylmethyl)phenyl]methylamino]-1,1-dihydroxy-3-oxoisoindol-2-yl]piperidine-2,6-dione (PubChem CID 145070586) has the molecular formula C27H33FN4O6 and a molecular weight of 528.58 g/mol. Its IUPAC name is ethane;3-[7-[[2-fluoro-5-(morpholin-4-ylmethyl)phenyl]methylamino]-1,1-dihydroxy-3-oxoisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | ethane;3-[7-[[2-fluoro-5-(morpholin-4-ylmethyl)phenyl]methylamino]-1,1-dihydroxy-3-oxoisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 145070586 |
| Molecular Formula | C27H33FN4O6 |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | ethane;3-[7-[[2-fluoro-5-(morpholin-4-ylmethyl)phenyl]methylamino]-1,1-dihydroxy-3-oxoisoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC.O=C1CCC(N2C(=O)c3cccc(NCc4cc(CN5CCOCC5)ccc4F)c3C2(O)O)C(=O)N1 |
| InChI | InChI=1S/C25H27FN4O6.C2H6/c26-18-5-4-15(14-29-8-10-36-11-9-29)12-16(18)13-27-19-3-1-2-17-22(19)25(34,35)30(24(17)33)20-6-7-21(31)28-23(20)32;1-2/h1-5,12,20,27,34-35H,6-11,13-14H2,(H,28,31,32);1-2H3 |
| InChIKey | LBZGPOJUZHTZGQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 131.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|