C25H28N4O8 — CID 145070510
3-hydroxy-3-[4,5,6-trihydroxy-7-[[2-(morpholin-4-ylmethyl)phenyl]methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 145070510) has the molecular formula C25H28N4O8 and a molecular weight of 512.52 g/mol. Its IUPAC name is 3-hydroxy-3-[4,5,6-trihydroxy-7-[[2-(morpholin-4-ylmethyl)phenyl]methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-hydroxy-3-[4,5,6-trihydroxy-7-[[2-(morpholin-4-ylmethyl)phenyl]methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 145070510 |
| Molecular Formula | C25H28N4O8 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 3-hydroxy-3-[4,5,6-trihydroxy-7-[[2-(morpholin-4-ylmethyl)phenyl]methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(O)(N2Cc3c(NCc4ccccc4CN4CCOCC4)c(O)c(O)c(O)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H28N4O8/c30-17-5-6-25(36,24(35)27-17)29-13-16-18(23(29)34)20(31)22(33)21(32)19(16)26-11-14-3-1-2-4-15(14)12-28-7-9-37-10-8-28/h1-4,26,31-33,36H,5-13H2,(H,27,30,35) |
| InChIKey | YFFANYMMLVMXAR-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 171.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|