C25H28N4O16 — CID 145070268
3,3,4,4,5-pentahydroxy-5-[4,5,6-trihydroxy-3-oxo-7-[[2,3,4,5-tetrahydroxy-6-(morpholin-4-ylmethyl)phenyl]methylamino]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 145070268) has the molecular formula C25H28N4O16 and a molecular weight of 640.51 g/mol. Its IUPAC name is 3,3,4,4,5-pentahydroxy-5-[4,5,6-trihydroxy-3-oxo-7-[[2,3,4,5-tetrahydroxy-6-(morpholin-4-ylmethyl)phenyl]methylamino]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3,3,4,4,5-pentahydroxy-5-[4,5,6-trihydroxy-3-oxo-7-[[2,3,4,5-tetrahydroxy-6-(morpholin-4-ylmethyl)phenyl]methylamino]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 145070268 |
| Molecular Formula | C25H28N4O16 |
| Molecular Weight | 640.51 g/mol |
| Exact Mass | 640.15 |
| IUPAC Name | 3,3,4,4,5-pentahydroxy-5-[4,5,6-trihydroxy-3-oxo-7-[[2,3,4,5-tetrahydroxy-6-(morpholin-4-ylmethyl)phenyl]methylamino]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1c2c(O)c(O)c(O)c(NCc3c(O)c(O)c(O)c(O)c3CN3CCOCC3)c2CN1C1(O)C(=O)NC(=O)C(O)(O)C1(O)O |
| InChI | InChI=1S/C25H28N4O16/c30-13-8(9(14(31)18(35)17(13)34)6-28-1-3-45-4-2-28)5-26-12-10-7-29(20(37)11(10)15(32)19(36)16(12)33)23(40)21(38)27-22(39)24(41,42)25(23,43)44/h26,30-36,40-44H,1-7H2,(H,27,38,39) |
| InChIKey | WAOPPWAOEBZEBI-UHFFFAOYSA-N |
| XLogP | -4.27 |
| TPSA | 333.74 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.51 |
| LogP ≤ 5 | -4.27 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|