C25H28N3O12P — CID 139422093
3-[1,1-dihydroxy-7-[[4-(morpholin-4-ylmethyl)-2-phosphanylphenyl]methoxy]-3-oxoisoindol-2-yl]-3,4,4,5,5-pentahydroxypiperidine-2,6-dione (PubChem CID 139422093) has the molecular formula C25H28N3O12P and a molecular weight of 593.48 g/mol. Its IUPAC name is 3-[1,1-dihydroxy-7-[[4-(morpholin-4-ylmethyl)-2-phosphanylphenyl]methoxy]-3-oxoisoindol-2-yl]-3,4,4,5,5-pentahydroxypiperidine-2,6-dione.
| Compound Name | 3-[1,1-dihydroxy-7-[[4-(morpholin-4-ylmethyl)-2-phosphanylphenyl]methoxy]-3-oxoisoindol-2-yl]-3,4,4,5,5-pentahydroxypiperidine-2,6-dione |
|---|---|
| PubChem CID | 139422093 |
| Molecular Formula | C25H28N3O12P |
| Molecular Weight | 593.48 g/mol |
| Exact Mass | 593.14 |
| IUPAC Name | 3-[1,1-dihydroxy-7-[[4-(morpholin-4-ylmethyl)-2-phosphanylphenyl]methoxy]-3-oxoisoindol-2-yl]-3,4,4,5,5-pentahydroxypiperidine-2,6-dione |
| SMILES | O=C1c2cccc(OCc3ccc(CN4CCOCC4)cc3P)c2C(O)(O)N1C1(O)C(=O)NC(=O)C(O)(O)C1(O)O |
| InChI | InChI=1S/C25H28N3O12P/c29-19-15-2-1-3-16(40-12-14-5-4-13(10-17(14)41)11-27-6-8-39-9-7-27)18(15)24(35,36)28(19)22(32)20(30)26-21(31)23(33,34)25(22,37)38/h1-5,10,32-38H,6-9,11-12,41H2,(H,26,30,31) |
| InChIKey | SOYUVZZHOUNCBL-UHFFFAOYSA-N |
| XLogP | -4.14 |
| TPSA | 229.79 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.48 |
| LogP ≤ 5 | -4.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|