C27H32FN3O9 — CID 145070306
ethane;5-[7-[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-3,3,4,4-tetrahydroxypiperidine-2,6-dione (PubChem CID 145070306) has the molecular formula C27H32FN3O9 and a molecular weight of 561.56 g/mol. Its IUPAC name is ethane;5-[7-[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-3,3,4,4-tetrahydroxypiperidine-2,6-dione.
| Compound Name | ethane;5-[7-[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-3,3,4,4-tetrahydroxypiperidine-2,6-dione |
|---|---|
| PubChem CID | 145070306 |
| Molecular Formula | C27H32FN3O9 |
| Molecular Weight | 561.56 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | ethane;5-[7-[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-3,3,4,4-tetrahydroxypiperidine-2,6-dione |
| SMILES | CC.O=C1NC(=O)C(O)(O)C(O)(O)C1N1Cc2c(OCc3ccc(CN4CCOCC4)cc3F)cccc2C1=O |
| InChI | InChI=1S/C25H26FN3O9.C2H6/c26-18-10-14(11-28-6-8-37-9-7-28)4-5-15(18)13-38-19-3-1-2-16-17(19)12-29(22(16)31)20-21(30)27-23(32)25(35,36)24(20,33)34;1-2/h1-5,10,20,33-36H,6-9,11-13H2,(H,27,30,32);1-2H3 |
| InChIKey | UYNKBIFZQQCCPJ-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 169.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.56 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|