C27H32FN3O12 — CID 142374361
ethane;5-[7-[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]methoxy]-4,5,6-trihydroxy-3-oxo-1H-isoindol-2-yl]-3,3,4,4-tetrahydroxypiperidine-2,6-dione (PubChem CID 142374361) has the molecular formula C27H32FN3O12 and a molecular weight of 609.56 g/mol. Its IUPAC name is ethane;5-[7-[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]methoxy]-4,5,6-trihydroxy-3-oxo-1H-isoindol-2-yl]-3,3,4,4-tetrahydroxypiperidine-2,6-dione.
| Compound Name | ethane;5-[7-[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]methoxy]-4,5,6-trihydroxy-3-oxo-1H-isoindol-2-yl]-3,3,4,4-tetrahydroxypiperidine-2,6-dione |
|---|---|
| PubChem CID | 142374361 |
| Molecular Formula | C27H32FN3O12 |
| Molecular Weight | 609.56 g/mol |
| Exact Mass | 609.20 |
| IUPAC Name | ethane;5-[7-[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]methoxy]-4,5,6-trihydroxy-3-oxo-1H-isoindol-2-yl]-3,3,4,4-tetrahydroxypiperidine-2,6-dione |
| SMILES | CC.O=C1NC(=O)C(O)(O)C(O)(O)C1N1Cc2c(OCc3ccc(CN4CCOCC4)cc3F)c(O)c(O)c(O)c2C1=O |
| InChI | InChI=1S/C25H26FN3O12.C2H6/c26-14-7-11(8-28-3-5-40-6-4-28)1-2-12(14)10-41-19-13-9-29(22(34)15(13)16(30)17(31)18(19)32)20-21(33)27-23(35)25(38,39)24(20,36)37;1-2/h1-2,7,20,30-32,36-39H,3-6,8-10H2,(H,27,33,35);1-2H3 |
| InChIKey | BBBUZJCZQOQBMV-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 229.79 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.56 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|