C26H30FN3O12 — CID 142374517
2-[7-[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]methoxy]-1,1-dihydroxy-3-oxoisoindol-2-yl]-2,3,3,4,4-pentahydroxy-N-methyl-5-oxopentanamide (PubChem CID 142374517) has the molecular formula C26H30FN3O12 and a molecular weight of 595.53 g/mol. Its IUPAC name is 2-[7-[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]methoxy]-1,1-dihydroxy-3-oxoisoindol-2-yl]-2,3,3,4,4-pentahydroxy-N-methyl-5-oxopentanamide.
| Compound Name | 2-[7-[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]methoxy]-1,1-dihydroxy-3-oxoisoindol-2-yl]-2,3,3,4,4-pentahydroxy-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 142374517 |
| Molecular Formula | C26H30FN3O12 |
| Molecular Weight | 595.53 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | 2-[7-[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]methoxy]-1,1-dihydroxy-3-oxoisoindol-2-yl]-2,3,3,4,4-pentahydroxy-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(O)(N1C(=O)c2cccc(OCc3ccc(CN4CCOCC4)cc3F)c2C1(O)O)C(O)(O)C(O)(O)C=O |
| InChI | InChI=1S/C26H30FN3O12/c1-28-22(33)24(36,26(39,40)23(34,35)14-31)30-21(32)17-3-2-4-19(20(17)25(30,37)38)42-13-16-6-5-15(11-18(16)27)12-29-7-9-41-10-8-29/h2-6,11,14,34-40H,7-10,12-13H2,1H3,(H,28,33) |
| InChIKey | OASIJLIDYXQGDA-UHFFFAOYSA-N |
| XLogP | -3.22 |
| TPSA | 229.79 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.53 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|