C26H30FN3O16 — CID 145070314
2-[7-[[2-fluoro-3,4,6-trihydroxy-5-(morpholin-4-ylmethyl)phenyl]methoxy]-4,5,6-trihydroxy-3-oxo-1H-isoindol-2-yl]-2,3,3,4,4-pentahydroxy-N-methyl-5-oxopentanamide (PubChem CID 145070314) has the molecular formula C26H30FN3O16 and a molecular weight of 659.53 g/mol. Its IUPAC name is 2-[7-[[2-fluoro-3,4,6-trihydroxy-5-(morpholin-4-ylmethyl)phenyl]methoxy]-4,5,6-trihydroxy-3-oxo-1H-isoindol-2-yl]-2,3,3,4,4-pentahydroxy-N-methyl-5-oxopentanamide.
| Compound Name | 2-[7-[[2-fluoro-3,4,6-trihydroxy-5-(morpholin-4-ylmethyl)phenyl]methoxy]-4,5,6-trihydroxy-3-oxo-1H-isoindol-2-yl]-2,3,3,4,4-pentahydroxy-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 145070314 |
| Molecular Formula | C26H30FN3O16 |
| Molecular Weight | 659.53 g/mol |
| Exact Mass | 659.16 |
| IUPAC Name | 2-[7-[[2-fluoro-3,4,6-trihydroxy-5-(morpholin-4-ylmethyl)phenyl]methoxy]-4,5,6-trihydroxy-3-oxo-1H-isoindol-2-yl]-2,3,3,4,4-pentahydroxy-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(O)(N1Cc2c(OCc3c(O)c(CN4CCOCC4)c(O)c(O)c3F)c(O)c(O)c(O)c2C1=O)C(O)(O)C(O)(O)C=O |
| InChI | InChI=1S/C26H30FN3O16/c1-28-23(39)25(42,26(43,44)24(40,41)9-31)30-7-10-13(22(30)38)17(34)19(36)20(37)21(10)46-8-12-14(27)18(35)16(33)11(15(12)32)6-29-2-4-45-5-3-29/h9,32-37,40-44H,2-8H2,1H3,(H,28,39) |
| InChIKey | KRAFDHAUDMMVPD-UHFFFAOYSA-N |
| XLogP | -3.58 |
| TPSA | 310.71 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.53 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|