C26H33N4O11P — CID 142374590
3,3,4,4-tetrahydroxy-N-methyl-5-oxo-2-[3-oxo-7-[[2,3,5-trihydroxy-4-(morpholin-4-ylmethyl)-6-phosphanylphenyl]methylamino]-1H-isoindol-2-yl]pentanamide (PubChem CID 142374590) has the molecular formula C26H33N4O11P and a molecular weight of 608.54 g/mol. Its IUPAC name is 3,3,4,4-tetrahydroxy-N-methyl-5-oxo-2-[3-oxo-7-[[2,3,5-trihydroxy-4-(morpholin-4-ylmethyl)-6-phosphanylphenyl]methylamino]-1H-isoindol-2-yl]pentanamide.
| Compound Name | 3,3,4,4-tetrahydroxy-N-methyl-5-oxo-2-[3-oxo-7-[[2,3,5-trihydroxy-4-(morpholin-4-ylmethyl)-6-phosphanylphenyl]methylamino]-1H-isoindol-2-yl]pentanamide |
|---|---|
| PubChem CID | 142374590 |
| Molecular Formula | C26H33N4O11P |
| Molecular Weight | 608.54 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | 3,3,4,4-tetrahydroxy-N-methyl-5-oxo-2-[3-oxo-7-[[2,3,5-trihydroxy-4-(morpholin-4-ylmethyl)-6-phosphanylphenyl]methylamino]-1H-isoindol-2-yl]pentanamide |
| SMILES | CNC(=O)C(N1Cc2c(NCc3c(O)c(O)c(CN4CCOCC4)c(O)c3P)cccc2C1=O)C(O)(O)C(O)(O)C=O |
| InChI | InChI=1S/C26H33N4O11P/c1-27-23(35)22(26(39,40)25(37,38)12-31)30-11-15-13(24(30)36)3-2-4-17(15)28-9-14-18(32)19(33)16(20(34)21(14)42)10-29-5-7-41-8-6-29/h2-4,12,22,28,32-34,37-40H,5-11,42H2,1H3,(H,27,35) |
| InChIKey | FRJDAEVPVLHCCT-UHFFFAOYSA-N |
| XLogP | -2.62 |
| TPSA | 232.59 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.54 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|