C27H34N4O6 — CID 145069988
4-[7-[[dihydroxy-[2-(morpholin-4-ylmethyl)phenyl]methyl]amino]-3-oxo-1H-isoindol-2-yl]-4-hydroxy-5-(methylamino)hex-5-enal (PubChem CID 145069988) has the molecular formula C27H34N4O6 and a molecular weight of 510.59 g/mol. Its IUPAC name is 4-[7-[[dihydroxy-[2-(morpholin-4-ylmethyl)phenyl]methyl]amino]-3-oxo-1H-isoindol-2-yl]-4-hydroxy-5-(methylamino)hex-5-enal.
| Compound Name | 4-[7-[[dihydroxy-[2-(morpholin-4-ylmethyl)phenyl]methyl]amino]-3-oxo-1H-isoindol-2-yl]-4-hydroxy-5-(methylamino)hex-5-enal |
|---|---|
| PubChem CID | 145069988 |
| Molecular Formula | C27H34N4O6 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 4-[7-[[dihydroxy-[2-(morpholin-4-ylmethyl)phenyl]methyl]amino]-3-oxo-1H-isoindol-2-yl]-4-hydroxy-5-(methylamino)hex-5-enal |
| SMILES | C=C(NC)C(O)(CCC=O)N1Cc2c(NC(O)(O)c3ccccc3CN3CCOCC3)cccc2C1=O |
| InChI | InChI=1S/C27H34N4O6/c1-19(28-2)26(34,11-6-14-32)31-18-22-21(25(31)33)8-5-10-24(22)29-27(35,36)23-9-4-3-7-20(23)17-30-12-15-37-16-13-30/h3-5,7-10,14,28-29,34-36H,1,6,11-13,15-18H2,2H3 |
| InChIKey | ROFTXGCQHRDHGG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 134.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|