C27H34N4O10 — CID 145070587
2-[1,1-dihydroxy-7-[[4-(morpholin-4-ylmethyl)phenyl]methylamino]-3-oxoisoindol-2-yl]-2,3,3,4,4-pentahydroxy-N-methylhex-5-enamide (PubChem CID 145070587) has the molecular formula C27H34N4O10 and a molecular weight of 574.59 g/mol. Its IUPAC name is 2-[1,1-dihydroxy-7-[[4-(morpholin-4-ylmethyl)phenyl]methylamino]-3-oxoisoindol-2-yl]-2,3,3,4,4-pentahydroxy-N-methylhex-5-enamide.
| Compound Name | 2-[1,1-dihydroxy-7-[[4-(morpholin-4-ylmethyl)phenyl]methylamino]-3-oxoisoindol-2-yl]-2,3,3,4,4-pentahydroxy-N-methylhex-5-enamide |
|---|---|
| PubChem CID | 145070587 |
| Molecular Formula | C27H34N4O10 |
| Molecular Weight | 574.59 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | 2-[1,1-dihydroxy-7-[[4-(morpholin-4-ylmethyl)phenyl]methylamino]-3-oxoisoindol-2-yl]-2,3,3,4,4-pentahydroxy-N-methylhex-5-enamide |
| SMILES | C=CC(O)(O)C(O)(O)C(O)(C(=O)NC)N1C(=O)c2cccc(NCc3ccc(CN4CCOCC4)cc3)c2C1(O)O |
| InChI | InChI=1S/C27H34N4O10/c1-3-24(34,35)27(39,40)25(36,23(33)28-2)31-22(32)19-5-4-6-20(21(19)26(31,37)38)29-15-17-7-9-18(10-8-17)16-30-11-13-41-14-12-30/h3-10,29,34-40H,1,11-16H2,2H3,(H,28,33) |
| InChIKey | WWGYCJOYHDHLSV-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 215.52 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.59 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|