C19H27N2O6P — CID 70973752
(2R)-5,7-dihydroxy-6,8-bis(morpholin-4-ylmethyl)-2-phosphanyl-2,3-dihydrochromen-4-one (PubChem CID 70973752) has the molecular formula C19H27N2O6P and a molecular weight of 410.41 g/mol. Its IUPAC name is (2R)-5,7-dihydroxy-6,8-bis(morpholin-4-ylmethyl)-2-phosphanyl-2,3-dihydrochromen-4-one.
| Compound Name | (2R)-5,7-dihydroxy-6,8-bis(morpholin-4-ylmethyl)-2-phosphanyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 70973752 |
| Molecular Formula | C19H27N2O6P |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | (2R)-5,7-dihydroxy-6,8-bis(morpholin-4-ylmethyl)-2-phosphanyl-2,3-dihydrochromen-4-one |
| SMILES | O=C1C[C@@H](P)Oc2c(CN3CCOCC3)c(O)c(CN3CCOCC3)c(O)c21 |
| InChI | InChI=1S/C19H27N2O6P/c22-14-9-15(28)27-19-13(11-21-3-7-26-8-4-21)17(23)12(18(24)16(14)19)10-20-1-5-25-6-2-20/h15,23-24H,1-11,28H2/t15-/m1/s1 |
| InChIKey | BZDAWBUBHCKDSZ-OAHLLOKOSA-N |
| XLogP | 0.93 |
| TPSA | 91.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|