C25H26FN3O8 — CID 142374451
3-[7-[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]methoxy]-1,1-dihydroxy-3-oxoisoindol-2-yl]-3-hydroxypiperidine-2,6-dione (PubChem CID 142374451) has the molecular formula C25H26FN3O8 and a molecular weight of 515.49 g/mol. Its IUPAC name is 3-[7-[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]methoxy]-1,1-dihydroxy-3-oxoisoindol-2-yl]-3-hydroxypiperidine-2,6-dione.
| Compound Name | 3-[7-[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]methoxy]-1,1-dihydroxy-3-oxoisoindol-2-yl]-3-hydroxypiperidine-2,6-dione |
|---|---|
| PubChem CID | 142374451 |
| Molecular Formula | C25H26FN3O8 |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | 3-[7-[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]methoxy]-1,1-dihydroxy-3-oxoisoindol-2-yl]-3-hydroxypiperidine-2,6-dione |
| SMILES | O=C1CCC(O)(N2C(=O)c3cccc(OCc4ccc(CN5CCOCC5)cc4F)c3C2(O)O)C(=O)N1 |
| InChI | InChI=1S/C25H26FN3O8/c26-18-12-15(13-28-8-10-36-11-9-28)4-5-16(18)14-37-19-3-1-2-17-21(19)25(34,35)29(22(17)31)24(33)7-6-20(30)27-23(24)32/h1-5,12,33-35H,6-11,13-14H2,(H,27,30,32) |
| InChIKey | LNCZKLYWBQOLNZ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 148.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|