C30H38FN3O6 — CID 145070235
N-[[2-[[2-fluoro-5-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]phenyl]methoxy]-6-methylphenyl]methyl]-N-(3-hydroxy-2,6-dioxopiperidin-3-yl)formamide (PubChem CID 145070235) has the molecular formula C30H38FN3O6 and a molecular weight of 555.65 g/mol. Its IUPAC name is N-[[2-[[2-fluoro-5-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]phenyl]methoxy]-6-methylphenyl]methyl]-N-(3-hydroxy-2,6-dioxopiperidin-3-yl)formamide.
| Compound Name | N-[[2-[[2-fluoro-5-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]phenyl]methoxy]-6-methylphenyl]methyl]-N-(3-hydroxy-2,6-dioxopiperidin-3-yl)formamide |
|---|---|
| PubChem CID | 145070235 |
| Molecular Formula | C30H38FN3O6 |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | N-[[2-[[2-fluoro-5-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]phenyl]methoxy]-6-methylphenyl]methyl]-N-(3-hydroxy-2,6-dioxopiperidin-3-yl)formamide |
| SMILES | Cc1cccc(OCc2cc(CN3CC(C)(C)OC(C)(C)C3)ccc2F)c1CN(C=O)C1(O)CCC(=O)NC1=O |
| InChI | InChI=1S/C30H38FN3O6/c1-20-7-6-8-25(23(20)15-34(19-35)30(38)12-11-26(36)32-27(30)37)39-16-22-13-21(9-10-24(22)31)14-33-17-28(2,3)40-29(4,5)18-33/h6-10,13,19,38H,11-12,14-18H2,1-5H3,(H,32,36,37) |
| InChIKey | CRCZDCXBJRZDFF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|