C29H35N3O4 — CID 129236747
(3S)-6-[[4-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]methoxy]spiro[4,5-dihydro-2H-2-benzazepine-3,3'-piperidine]-1,2',6'-trione (PubChem CID 129236747) has the molecular formula C29H35N3O4 and a molecular weight of 489.62 g/mol. Its IUPAC name is (3S)-6-[[4-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]methoxy]spiro[4,5-dihydro-2H-2-benzazepine-3,3'-piperidine]-1,2',6'-trione.
| Compound Name | (3S)-6-[[4-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]methoxy]spiro[4,5-dihydro-2H-2-benzazepine-3,3'-piperidine]-1,2',6'-trione |
|---|---|
| PubChem CID | 129236747 |
| Molecular Formula | C29H35N3O4 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | (3S)-6-[[4-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]methoxy]spiro[4,5-dihydro-2H-2-benzazepine-3,3'-piperidine]-1,2',6'-trione |
| SMILES | CC1(C)CCN(Cc2ccc(COc3cccc4c3CC[C@@]3(CCC(=O)NC3=O)NC4=O)cc2)CC1 |
| InChI | InChI=1S/C29H35N3O4/c1-28(2)14-16-32(17-15-28)18-20-6-8-21(9-7-20)19-36-24-5-3-4-23-22(24)10-12-29(31-26(23)34)13-11-25(33)30-27(29)35/h3-9H,10-19H2,1-2H3,(H,31,34)(H,30,33,35)/t29-/m0/s1 |
| InChIKey | UJRMURYQDXBHOR-LJAQVGFWSA-N |
| XLogP | 3.74 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|