C25H24B3N3O5 — CID 144674106
CID 144674106 (PubChem CID 144674106) has the molecular formula C25H24B3N3O5 and a molecular weight of 478.92 g/mol.
| Compound Name | CID 144674106 |
|---|---|
| PubChem CID | 144674106 |
| Molecular Formula | C25H24B3N3O5 |
| Molecular Weight | 478.92 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | — |
| SMILES | [B]C1([B])CC([B])(N2Cc3c(OCc4ccc(CN5CCOCC5)cc4)cccc3C2=O)C(=O)NC1=O |
| InChI | InChI=1S/C25H24B3N3O5/c26-24(27)15-25(28,23(34)29-22(24)33)31-13-19-18(21(31)32)2-1-3-20(19)36-14-17-6-4-16(5-7-17)12-30-8-10-35-11-9-30/h1-7H,8-15H2,(H,29,33,34) |
| InChIKey | SSIIVVLVRWZQHR-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.92 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|