C26H30N2O5 — CID 129236680
2-[7-[[4-(1,4-oxazepan-4-ylmethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]pentanedial (PubChem CID 129236680) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is 2-[7-[[4-(1,4-oxazepan-4-ylmethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]pentanedial.
| Compound Name | 2-[7-[[4-(1,4-oxazepan-4-ylmethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]pentanedial |
|---|---|
| PubChem CID | 129236680 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 2-[7-[[4-(1,4-oxazepan-4-ylmethyl)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]pentanedial |
| SMILES | O=CCCC(C=O)N1Cc2c(OCc3ccc(CN4CCCOCC4)cc3)cccc2C1=O |
| InChI | InChI=1S/C26H30N2O5/c29-13-2-4-22(18-30)28-17-24-23(26(28)31)5-1-6-25(24)33-19-21-9-7-20(8-10-21)16-27-11-3-14-32-15-12-27/h1,5-10,13,18,22H,2-4,11-12,14-17,19H2 |
| InChIKey | CHBHNWSUHCPPQE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|