C20H21NO4 — CID 5398300
2-ethyl-3-hydroxy-4-(morpholin-4-ylmethyl)benzo[c]chromen-6-one (PubChem CID 5398300) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-ethyl-3-hydroxy-4-(morpholin-4-ylmethyl)benzo[c]chromen-6-one.
| Compound Name | 2-ethyl-3-hydroxy-4-(morpholin-4-ylmethyl)benzo[c]chromen-6-one |
|---|---|
| PubChem CID | 5398300 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-ethyl-3-hydroxy-4-(morpholin-4-ylmethyl)benzo[c]chromen-6-one |
| SMILES | CCc1cc2c(oc(=O)c3ccccc32)c(CN2CCOCC2)c1O |
| InChI | InChI=1S/C20H21NO4/c1-2-13-11-16-14-5-3-4-6-15(14)20(23)25-19(16)17(18(13)22)12-21-7-9-24-10-8-21/h3-6,11,22H,2,7-10,12H2,1H3 |
| InChIKey | UCSWEPKHZVLRCQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|