C17H24FN3O6 — CID 145070038
3-(7-amino-5-fluoro-4,6-dihydroxy-3-oxo-1H-isoindol-2-yl)-3-hydroxypiperidine-2,6-dione;ethane (PubChem CID 145070038) has the molecular formula C17H24FN3O6 and a molecular weight of 385.39 g/mol. Its IUPAC name is 3-(7-amino-5-fluoro-4,6-dihydroxy-3-oxo-1H-isoindol-2-yl)-3-hydroxypiperidine-2,6-dione;ethane.
| Compound Name | 3-(7-amino-5-fluoro-4,6-dihydroxy-3-oxo-1H-isoindol-2-yl)-3-hydroxypiperidine-2,6-dione;ethane |
|---|---|
| PubChem CID | 145070038 |
| Molecular Formula | C17H24FN3O6 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 3-(7-amino-5-fluoro-4,6-dihydroxy-3-oxo-1H-isoindol-2-yl)-3-hydroxypiperidine-2,6-dione;ethane |
| SMILES | CC.CC.Nc1c(O)c(F)c(O)c2c1CN(C1(O)CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C13H12FN3O6.2C2H6/c14-7-9(19)6-4(8(15)10(7)20)3-17(11(6)21)13(23)2-1-5(18)16-12(13)22;2*1-2/h19-20,23H,1-3,15H2,(H,16,18,22);2*1-2H3 |
| InChIKey | ZYCNDSYEQJHRRV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 153.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|