C15H14FN3O3 — CID 164919999
3-fluoro-3-(3-oxo-1,6,7,8-tetrahydropyrrolo[3,4-e]isoindol-2-yl)piperidine-2,6-dione (PubChem CID 164919999) has the molecular formula C15H14FN3O3 and a molecular weight of 303.29 g/mol. Its IUPAC name is 3-fluoro-3-(3-oxo-1,6,7,8-tetrahydropyrrolo[3,4-e]isoindol-2-yl)piperidine-2,6-dione.
| Compound Name | 3-fluoro-3-(3-oxo-1,6,7,8-tetrahydropyrrolo[3,4-e]isoindol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 164919999 |
| Molecular Formula | C15H14FN3O3 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 3-fluoro-3-(3-oxo-1,6,7,8-tetrahydropyrrolo[3,4-e]isoindol-2-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(F)(N2Cc3c(ccc4c3CNC4)C2=O)C(=O)N1 |
| InChI | InChI=1S/C15H14FN3O3/c16-15(4-3-12(20)18-14(15)22)19-7-11-9(13(19)21)2-1-8-5-17-6-10(8)11/h1-2,17H,3-7H2,(H,18,20,22) |
| InChIKey | NMCYVSQJXCYCMG-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|