C17H19N3O3 — CID 164920294
spiro[4,5,8,9,10,11-hexahydro-2H-pyrido[3,4-i][2]benzazepine-3,3'-piperidine]-1,2',6'-trione (PubChem CID 164920294) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is spiro[4,5,8,9,10,11-hexahydro-2H-pyrido[3,4-i][2]benzazepine-3,3'-piperidine]-1,2',6'-trione.
| Compound Name | spiro[4,5,8,9,10,11-hexahydro-2H-pyrido[3,4-i][2]benzazepine-3,3'-piperidine]-1,2',6'-trione |
|---|---|
| PubChem CID | 164920294 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | spiro[4,5,8,9,10,11-hexahydro-2H-pyrido[3,4-i][2]benzazepine-3,3'-piperidine]-1,2',6'-trione |
| SMILES | O=C1CCC2(CCc3ccc4c(c3C(=O)N2)CCNC4)C(=O)N1 |
| InChI | InChI=1S/C17H19N3O3/c21-13-4-7-17(16(23)19-13)6-3-10-1-2-11-9-18-8-5-12(11)14(10)15(22)20-17/h1-2,18H,3-9H2,(H,20,22)(H,19,21,23) |
| InChIKey | RXFMSFIMMPWMIN-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|