C14H14BN3O3S — CID 174071294
CID 174071294 (PubChem CID 174071294) has the molecular formula C14H14BN3O3S and a molecular weight of 315.16 g/mol.
| Compound Name | CID 174071294 |
|---|---|
| PubChem CID | 174071294 |
| Molecular Formula | C14H14BN3O3S |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | — |
| SMILES | [B]C1(N2Cc3cc(NCS)ccc3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C14H14BN3O3S/c15-14(4-3-11(19)17-13(14)21)18-6-8-5-9(16-7-22)1-2-10(8)12(18)20/h1-2,5,16,22H,3-4,6-7H2,(H,17,19,21) |
| InChIKey | AHSXEHMMYXPFFP-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|