C27H25N5O4 — CID 91303118
1-[[2-(3-methyl-2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-(4-pyridin-4-ylphenyl)urea (PubChem CID 91303118) has the molecular formula C27H25N5O4 and a molecular weight of 483.53 g/mol. Its IUPAC name is 1-[[2-(3-methyl-2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-(4-pyridin-4-ylphenyl)urea.
| Compound Name | 1-[[2-(3-methyl-2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-(4-pyridin-4-ylphenyl)urea |
|---|---|
| PubChem CID | 91303118 |
| Molecular Formula | C27H25N5O4 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 1-[[2-(3-methyl-2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-(4-pyridin-4-ylphenyl)urea |
| SMILES | CC1(N2Cc3cc(CNC(=O)Nc4ccc(-c5ccncc5)cc4)ccc3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C27H25N5O4/c1-27(11-8-23(33)31-25(27)35)32-16-20-14-17(2-7-22(20)24(32)34)15-29-26(36)30-21-5-3-18(4-6-21)19-9-12-28-13-10-19/h2-7,9-10,12-14H,8,11,15-16H2,1H3,(H2,29,30,36)(H,31,33,35) |
| InChIKey | UBNJEWVCQKOPOC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|