C22H16BClF3N3O4 — CID 174095830
CID 174095830 (PubChem CID 174095830) has the molecular formula C22H16BClF3N3O4 and a molecular weight of 489.65 g/mol.
| Compound Name | CID 174095830 |
|---|---|
| PubChem CID | 174095830 |
| Molecular Formula | C22H16BClF3N3O4 |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | — |
| SMILES | [B][C@]1(N2Cc3cc(CNC(=O)C(F)(F)c4ccc(Cl)cc4F)ccc3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C22H16BClF3N3O4/c23-21(6-5-17(31)29-19(21)33)30-10-12-7-11(1-3-14(12)18(30)32)9-28-20(34)22(26,27)15-4-2-13(24)8-16(15)25/h1-4,7-8H,5-6,9-10H2,(H,28,34)(H,29,31,33)/t21-/m0/s1 |
| InChIKey | CNBGRXANGOPESB-NRFANRHFSA-N |
| XLogP | 2.14 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|