C10H9FN2O4S — CID 141156648
(3S)-3-fluoro-3-(4-hydroxy-3H-thieno[3,4-d][1,2]oxazol-2-yl)piperidine-2,6-dione (PubChem CID 141156648) has the molecular formula C10H9FN2O4S and a molecular weight of 272.26 g/mol. Its IUPAC name is (3S)-3-fluoro-3-(4-hydroxy-3H-thieno[3,4-d][1,2]oxazol-2-yl)piperidine-2,6-dione.
| Compound Name | (3S)-3-fluoro-3-(4-hydroxy-3H-thieno[3,4-d][1,2]oxazol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 141156648 |
| Molecular Formula | C10H9FN2O4S |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | (3S)-3-fluoro-3-(4-hydroxy-3H-thieno[3,4-d][1,2]oxazol-2-yl)piperidine-2,6-dione |
| SMILES | O=C1CC[C@@](F)(N2Cc3c(csc3O)O2)C(=O)N1 |
| InChI | InChI=1S/C10H9FN2O4S/c11-10(2-1-7(14)12-9(10)16)13-3-5-6(17-13)4-18-8(5)15/h4,15H,1-3H2,(H,12,14,16)/t10-/m1/s1 |
| InChIKey | UDTDCALXKDIUAP-SNVBAGLBSA-N |
| XLogP | 0.67 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|