C11H13NO2S — CID 16639181
3-ethyl-3-thiophen-2-ylpiperidine-2,6-dione (PubChem CID 16639181) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 3-ethyl-3-thiophen-2-ylpiperidine-2,6-dione.
| Compound Name | 3-ethyl-3-thiophen-2-ylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 16639181 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 3-ethyl-3-thiophen-2-ylpiperidine-2,6-dione |
| SMILES | CCC1(c2cccs2)CCC(=O)NC1=O |
| InChI | InChI=1S/C11H13NO2S/c1-2-11(8-4-3-7-15-8)6-5-9(13)12-10(11)14/h3-4,7H,2,5-6H2,1H3,(H,12,13,14) |
| InChIKey | NGZPQDZKGKROHS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|