C13H12FN3O8 — CID 145070829
3-(7-amino-5-fluoro-4,6-dihydroxy-3-oxo-1H-isoindol-2-yl)-3,4,5-trihydroxypiperidine-2,6-dione (PubChem CID 145070829) has the molecular formula C13H12FN3O8 and a molecular weight of 357.25 g/mol. Its IUPAC name is 3-(7-amino-5-fluoro-4,6-dihydroxy-3-oxo-1H-isoindol-2-yl)-3,4,5-trihydroxypiperidine-2,6-dione.
| Compound Name | 3-(7-amino-5-fluoro-4,6-dihydroxy-3-oxo-1H-isoindol-2-yl)-3,4,5-trihydroxypiperidine-2,6-dione |
|---|---|
| PubChem CID | 145070829 |
| Molecular Formula | C13H12FN3O8 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 3-(7-amino-5-fluoro-4,6-dihydroxy-3-oxo-1H-isoindol-2-yl)-3,4,5-trihydroxypiperidine-2,6-dione |
| SMILES | Nc1c(O)c(F)c(O)c2c1CN(C1(O)C(=O)NC(=O)C(O)C1O)C2=O |
| InChI | InChI=1S/C13H12FN3O8/c14-4-6(18)3-2(5(15)7(4)19)1-17(11(3)23)13(25)9(21)8(20)10(22)16-12(13)24/h8-9,18-21,25H,1,15H2,(H,16,22,24) |
| InChIKey | YLTUECVHQYYUGX-UHFFFAOYSA-N |
| XLogP | -3.16 |
| TPSA | 193.65 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|