C13H12N2O6 — CID 91408352
5-[3,4-bis(ethenyl)-2,5-dioxopyrrol-1-yl]-3,3-dihydroxypiperidine-2,6-dione (PubChem CID 91408352) has the molecular formula C13H12N2O6 and a molecular weight of 292.25 g/mol. Its IUPAC name is 5-[3,4-bis(ethenyl)-2,5-dioxopyrrol-1-yl]-3,3-dihydroxypiperidine-2,6-dione.
| Compound Name | 5-[3,4-bis(ethenyl)-2,5-dioxopyrrol-1-yl]-3,3-dihydroxypiperidine-2,6-dione |
|---|---|
| PubChem CID | 91408352 |
| Molecular Formula | C13H12N2O6 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 5-[3,4-bis(ethenyl)-2,5-dioxopyrrol-1-yl]-3,3-dihydroxypiperidine-2,6-dione |
| SMILES | C=CC1=C(C=C)C(=O)N(C2CC(O)(O)C(=O)NC2=O)C1=O |
| InChI | InChI=1S/C13H12N2O6/c1-3-6-7(4-2)11(18)15(10(6)17)8-5-13(20,21)12(19)14-9(8)16/h3-4,8,20-21H,1-2,5H2,(H,14,16,19) |
| InChIKey | WROWUMKQJPMPLP-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|