C16H14N2O4 — CID 165166632
2-(4,6-dioxo-5-azaspiro[2.5]octan-7-yl)-5-methylisoindole-1,3-dione (PubChem CID 165166632) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is 2-(4,6-dioxo-5-azaspiro[2.5]octan-7-yl)-5-methylisoindole-1,3-dione.
| Compound Name | 2-(4,6-dioxo-5-azaspiro[2.5]octan-7-yl)-5-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 165166632 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-(4,6-dioxo-5-azaspiro[2.5]octan-7-yl)-5-methylisoindole-1,3-dione |
| SMILES | Cc1ccc2c(c1)C(=O)N(C1CC3(CC3)C(=O)NC1=O)C2=O |
| InChI | InChI=1S/C16H14N2O4/c1-8-2-3-9-10(6-8)14(21)18(13(9)20)11-7-16(4-5-16)15(22)17-12(11)19/h2-3,6,11H,4-5,7H2,1H3,(H,17,19,22) |
| InChIKey | VUVVCJQCYCTSPA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|