C17H22N2O4 — CID 157028606
ethane;5-methyl-2-(7-oxo-1-oxa-8-azaspiro[2.5]octan-4-yl)isoindole-1,3-dione;molecular hydrogen (PubChem CID 157028606) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is ethane;5-methyl-2-(7-oxo-1-oxa-8-azaspiro[2.5]octan-4-yl)isoindole-1,3-dione;molecular hydrogen.
| Compound Name | ethane;5-methyl-2-(7-oxo-1-oxa-8-azaspiro[2.5]octan-4-yl)isoindole-1,3-dione;molecular hydrogen |
|---|---|
| PubChem CID | 157028606 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | ethane;5-methyl-2-(7-oxo-1-oxa-8-azaspiro[2.5]octan-4-yl)isoindole-1,3-dione;molecular hydrogen |
| SMILES | CC.Cc1ccc2c(c1)C(=O)N(C1CCC(=O)NC13CO3)C2=O.[H][H] |
| InChI | InChI=1S/C15H14N2O4.C2H6.H2/c1-8-2-3-9-10(6-8)14(20)17(13(9)19)11-4-5-12(18)16-15(11)7-21-15;1-2;/h2-3,6,11H,4-5,7H2,1H3,(H,16,18);1-2H3;1H |
| InChIKey | KWJHTZZVHHNUNS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 79.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|