C20H21N3O3 — CID 176967648
(5Z)-5-(dimethylaminomethylidene)-4-ethenyl-2-(6-methylidene-2-oxopiperidin-3-yl)isoquinoline-1,3-dione (PubChem CID 176967648) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is (5Z)-5-(dimethylaminomethylidene)-4-ethenyl-2-(6-methylidene-2-oxopiperidin-3-yl)isoquinoline-1,3-dione.
| Compound Name | (5Z)-5-(dimethylaminomethylidene)-4-ethenyl-2-(6-methylidene-2-oxopiperidin-3-yl)isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 176967648 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (5Z)-5-(dimethylaminomethylidene)-4-ethenyl-2-(6-methylidene-2-oxopiperidin-3-yl)isoquinoline-1,3-dione |
| SMILES | C=CC1=c2c(ccc/c2=C/N(C)C)C(=O)N(C2CCC(=C)NC2=O)C1=O |
| InChI | InChI=1S/C20H21N3O3/c1-5-14-17-13(11-22(3)4)7-6-8-15(17)20(26)23(19(14)25)16-10-9-12(2)21-18(16)24/h5-8,11,16H,1-2,9-10H2,3-4H3,(H,21,24)/b13-11- |
| InChIKey | NTAIIUCADAUEQT-QBFSEMIESA-N |
| XLogP | 0.10 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|