C16H22N2O3 — CID 163267583
(3E,4E)-3,4-di(ethylidene)-1-[(3R)-6-methylidene-2-oxopiperidin-3-yl]pyrrolidine-2,5-dione;ethane (PubChem CID 163267583) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is (3E,4E)-3,4-di(ethylidene)-1-[(3R)-6-methylidene-2-oxopiperidin-3-yl]pyrrolidine-2,5-dione;ethane.
| Compound Name | (3E,4E)-3,4-di(ethylidene)-1-[(3R)-6-methylidene-2-oxopiperidin-3-yl]pyrrolidine-2,5-dione;ethane |
|---|---|
| PubChem CID | 163267583 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (3E,4E)-3,4-di(ethylidene)-1-[(3R)-6-methylidene-2-oxopiperidin-3-yl]pyrrolidine-2,5-dione;ethane |
| SMILES | C=C1CC[C@@H](N2C(=O)C(=C/C)/C(=C\C)C2=O)C(=O)N1.CC |
| InChI | InChI=1S/C14H16N2O3.C2H6/c1-4-9-10(5-2)14(19)16(13(9)18)11-7-6-8(3)15-12(11)17;1-2/h4-5,11H,3,6-7H2,1-2H3,(H,15,17);1-2H3/b9-4+,10-5+;/t11-;/m1./s1 |
| InChIKey | PZXJVJDVHNMBJW-MHFZFCIWSA-N |
| XLogP | 2.07 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|