C14H15NO2 — CID 142338376
1-(3-bicyclo[3.1.0]hexanyl)-3,4-bis(ethenyl)pyrrole-2,5-dione (PubChem CID 142338376) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 1-(3-bicyclo[3.1.0]hexanyl)-3,4-bis(ethenyl)pyrrole-2,5-dione.
| Compound Name | 1-(3-bicyclo[3.1.0]hexanyl)-3,4-bis(ethenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 142338376 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 1-(3-bicyclo[3.1.0]hexanyl)-3,4-bis(ethenyl)pyrrole-2,5-dione |
| SMILES | C=CC1=C(C=C)C(=O)N(C2CC3CC3C2)C1=O |
| InChI | InChI=1S/C14H15NO2/c1-3-11-12(4-2)14(17)15(13(11)16)10-6-8-5-9(8)7-10/h3-4,8-10H,1-2,5-7H2 |
| InChIKey | ICJONWHUQVELFE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|