C14H16N2O4 — CID 142554994
3-[3,4-bis(ethenyl)-2,5-dioxopyrrol-1-yl]-1-methoxycyclobutane-1-carboxamide (PubChem CID 142554994) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 3-[3,4-bis(ethenyl)-2,5-dioxopyrrol-1-yl]-1-methoxycyclobutane-1-carboxamide.
| Compound Name | 3-[3,4-bis(ethenyl)-2,5-dioxopyrrol-1-yl]-1-methoxycyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 142554994 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 3-[3,4-bis(ethenyl)-2,5-dioxopyrrol-1-yl]-1-methoxycyclobutane-1-carboxamide |
| SMILES | C=CC1=C(C=C)C(=O)N(C2CC(OC)(C(N)=O)C2)C1=O |
| InChI | InChI=1S/C14H16N2O4/c1-4-9-10(5-2)12(18)16(11(9)17)8-6-14(7-8,20-3)13(15)19/h4-5,8H,1-2,6-7H2,3H3,(H2,15,19) |
| InChIKey | UOPJPNRUOPQWIM-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|