C14H17NO4 — CID 155350963
methyl (E)-3-(4-ethenyl-2,5-dioxo-1-propan-2-ylpyrrol-3-yl)-2-methylprop-2-enoate (PubChem CID 155350963) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is methyl (E)-3-(4-ethenyl-2,5-dioxo-1-propan-2-ylpyrrol-3-yl)-2-methylprop-2-enoate.
| Compound Name | methyl (E)-3-(4-ethenyl-2,5-dioxo-1-propan-2-ylpyrrol-3-yl)-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155350963 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | methyl (E)-3-(4-ethenyl-2,5-dioxo-1-propan-2-ylpyrrol-3-yl)-2-methylprop-2-enoate |
| SMILES | C=CC1=C(/C=C(\C)C(=O)OC)C(=O)N(C(C)C)C1=O |
| InChI | InChI=1S/C14H17NO4/c1-6-10-11(7-9(4)14(18)19-5)13(17)15(8(2)3)12(10)16/h6-8H,1H2,2-5H3/b9-7+ |
| InChIKey | SWZUWZKXGIKJHT-VQHVLOKHSA-N |
| XLogP | 1.37 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|