C9H8O5 — CID 139680481
methyl (E)-3-(2,5-dioxofuran-3-yl)-2-methylprop-2-enoate (PubChem CID 139680481) has the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. Its IUPAC name is methyl (E)-3-(2,5-dioxofuran-3-yl)-2-methylprop-2-enoate.
| Compound Name | methyl (E)-3-(2,5-dioxofuran-3-yl)-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139680481 |
| Molecular Formula | C9H8O5 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | methyl (E)-3-(2,5-dioxofuran-3-yl)-2-methylprop-2-enoate |
| SMILES | COC(=O)/C(C)=C/C1=CC(=O)OC1=O |
| InChI | InChI=1S/C9H8O5/c1-5(8(11)13-2)3-6-4-7(10)14-9(6)12/h3-4H,1-2H3/b5-3+ |
| InChIKey | RYIGVASOFZOGJT-HWKANZROSA-N |
| XLogP | 0.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|