methyl (Z)-2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoate

C11H9F3O2 — CID 58445343

IUPACmethyl (Z)-2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoate
SMILESCOC(=O)/C(C)=C\c1c(F)ccc(F)c1F
InChIInChI=1S/C11H9F3O2/c1-6(11(15)16-2)5-7-8(12)3-4-9(13)10(7)14/h3-5H,1-2H3/b6-5-
InChIKeyLZGGEOBHRFKNKN-WAYWQWQTSA-N
MW230.18 g/mol
LogP2.68
Rot. Bonds2

About methyl (Z)-2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoate

methyl (Z)-2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoate (PubChem CID 58445343) has the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. Its IUPAC name is methyl (Z)-2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoate.

Molecular Properties

Compound Namemethyl (Z)-2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoate
PubChem CID58445343
Molecular FormulaC11H9F3O2
Molecular Weight230.18 g/mol
Exact Mass230.06
IUPAC Namemethyl (Z)-2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoate
SMILESCOC(=O)/C(C)=C\c1c(F)ccc(F)c1F
InChIInChI=1S/C11H9F3O2/c1-6(11(15)16-2)5-7-8(12)3-4-9(13)10(7)14/h3-5H,1-2H3/b6-5-
InChIKeyLZGGEOBHRFKNKN-WAYWQWQTSA-N
XLogP2.68
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.18
LogP ≤ 52.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (Z)-2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (Z)-2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoate?
The IUPAC name of methyl (Z)-2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoate (CID 58445343) is methyl (Z)-2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoate.
What is the SMILES notation for methyl (Z)-2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoate?
The canonical SMILES for methyl (Z)-2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoate is COC(=O)/C(C)=C\c1c(F)ccc(F)c1F.
What is the InChIKey of methyl (Z)-2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoate?
The InChIKey is LZGGEOBHRFKNKN-WAYWQWQTSA-N. The full InChI is InChI=1S/C11H9F3O2/c1-6(11(15)16-2)5-7-8(12)3-4-9(13)10(7)14/h3-5H,1-2H3/b6-5-.
What are the key properties of methyl (Z)-2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoate?
methyl (Z)-2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoate has a molecular weight of 230.18 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoate is sourced from PubChem (CID 58445343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).