C11H9F3O2 — CID 58445343
methyl (Z)-2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoate (PubChem CID 58445343) has the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. Its IUPAC name is methyl (Z)-2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoate.
| Compound Name | methyl (Z)-2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 58445343 |
| Molecular Formula | C11H9F3O2 |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | methyl (Z)-2-methyl-3-(2,3,6-trifluorophenyl)prop-2-enoate |
| SMILES | COC(=O)/C(C)=C\c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C11H9F3O2/c1-6(11(15)16-2)5-7-8(12)3-4-9(13)10(7)14/h3-5H,1-2H3/b6-5- |
| InChIKey | LZGGEOBHRFKNKN-WAYWQWQTSA-N |
| XLogP | 2.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|