C11H9BrF2O3 — CID 76724920
methyl 3-(4-bromo-2,6-difluorophenyl)-2-methoxyprop-2-enoate (PubChem CID 76724920) has the molecular formula C11H9BrF2O3 and a molecular weight of 307.09 g/mol. Its IUPAC name is methyl 3-(4-bromo-2,6-difluorophenyl)-2-methoxyprop-2-enoate.
| Compound Name | methyl 3-(4-bromo-2,6-difluorophenyl)-2-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 76724920 |
| Molecular Formula | C11H9BrF2O3 |
| Molecular Weight | 307.09 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | methyl 3-(4-bromo-2,6-difluorophenyl)-2-methoxyprop-2-enoate |
| SMILES | COC(=O)C(=Cc1c(F)cc(Br)cc1F)OC |
| InChI | InChI=1S/C11H9BrF2O3/c1-16-10(11(15)17-2)5-7-8(13)3-6(12)4-9(7)14/h3-5H,1-2H3 |
| InChIKey | FHJYBEBLUXBDCH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.09 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|