methyl 2-(4-bromo-2,6-difluorophenoxy)propanoate

C10H9BrF2O3 — CID 175054822

IUPACmethyl 2-(4-bromo-2,6-difluorophenoxy)propanoate
SMILESCOC(=O)C(C)Oc1c(F)cc(Br)cc1F
InChIInChI=1S/C10H9BrF2O3/c1-5(10(14)15-2)16-9-7(12)3-6(11)4-8(9)13/h3-5H,1-2H3
InChIKeyZWTRVNAGPBMQAC-UHFFFAOYSA-N
MW295.08 g/mol
LogP2.67
Rot. Bonds3

About methyl 2-(4-bromo-2,6-difluorophenoxy)propanoate

methyl 2-(4-bromo-2,6-difluorophenoxy)propanoate (PubChem CID 175054822) has the molecular formula C10H9BrF2O3 and a molecular weight of 295.08 g/mol. Its IUPAC name is methyl 2-(4-bromo-2,6-difluorophenoxy)propanoate.

Molecular Properties

Compound Namemethyl 2-(4-bromo-2,6-difluorophenoxy)propanoate
PubChem CID175054822
Molecular FormulaC10H9BrF2O3
Molecular Weight295.08 g/mol
Exact Mass293.97
IUPAC Namemethyl 2-(4-bromo-2,6-difluorophenoxy)propanoate
SMILESCOC(=O)C(C)Oc1c(F)cc(Br)cc1F
InChIInChI=1S/C10H9BrF2O3/c1-5(10(14)15-2)16-9-7(12)3-6(11)4-8(9)13/h3-5H,1-2H3
InChIKeyZWTRVNAGPBMQAC-UHFFFAOYSA-N
XLogP2.67
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.08
LogP ≤ 52.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-(4-bromo-2,6-difluorophenoxy)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(4-bromo-2,6-difluorophenoxy)propanoate?
The IUPAC name of methyl 2-(4-bromo-2,6-difluorophenoxy)propanoate (CID 175054822) is methyl 2-(4-bromo-2,6-difluorophenoxy)propanoate.
What is the SMILES notation for methyl 2-(4-bromo-2,6-difluorophenoxy)propanoate?
The canonical SMILES for methyl 2-(4-bromo-2,6-difluorophenoxy)propanoate is COC(=O)C(C)Oc1c(F)cc(Br)cc1F.
What is the InChIKey of methyl 2-(4-bromo-2,6-difluorophenoxy)propanoate?
The InChIKey is ZWTRVNAGPBMQAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrF2O3/c1-5(10(14)15-2)16-9-7(12)3-6(11)4-8(9)13/h3-5H,1-2H3.
What are the key properties of methyl 2-(4-bromo-2,6-difluorophenoxy)propanoate?
methyl 2-(4-bromo-2,6-difluorophenoxy)propanoate has a molecular weight of 295.08 g/mol, XLogP of 2.67, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-bromo-2,6-difluorophenoxy)propanoate is sourced from PubChem (CID 175054822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).