C11H12F2O4 — CID 79888346
methyl 2-[2,6-difluoro-4-(hydroxymethyl)phenoxy]propanoate (PubChem CID 79888346) has the molecular formula C11H12F2O4 and a molecular weight of 246.21 g/mol. Its IUPAC name is methyl 2-[2,6-difluoro-4-(hydroxymethyl)phenoxy]propanoate.
| Compound Name | methyl 2-[2,6-difluoro-4-(hydroxymethyl)phenoxy]propanoate |
|---|---|
| PubChem CID | 79888346 |
| Molecular Formula | C11H12F2O4 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | methyl 2-[2,6-difluoro-4-(hydroxymethyl)phenoxy]propanoate |
| SMILES | COC(=O)C(C)Oc1c(F)cc(CO)cc1F |
| InChI | InChI=1S/C11H12F2O4/c1-6(11(15)16-2)17-10-8(12)3-7(5-14)4-9(10)13/h3-4,6,14H,5H2,1-2H3 |
| InChIKey | AGTROJYUNBNTSM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |